C22H26N2O2S2 — CID 40863993
N-[(2S)-2-(azepan-1-yl)-2-thiophen-3-ylethyl]naphthalene-2-sulfonamide (PubChem CID 40863993) has the molecular formula C22H26N2O2S2 and a molecular weight of 414.60 g/mol. Its IUPAC name is N-[(2S)-2-(azepan-1-yl)-2-thiophen-3-ylethyl]naphthalene-2-sulfonamide.
| Compound Name | N-[(2S)-2-(azepan-1-yl)-2-thiophen-3-ylethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 40863993 |
| Molecular Formula | C22H26N2O2S2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-[(2S)-2-(azepan-1-yl)-2-thiophen-3-ylethyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NC[C@H](c1ccsc1)N1CCCCCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H26N2O2S2/c25-28(26,21-10-9-18-7-3-4-8-19(18)15-21)23-16-22(20-11-14-27-17-20)24-12-5-1-2-6-13-24/h3-4,7-11,14-15,17,22-23H,1-2,5-6,12-13,16H2/t22-/m1/s1 |
| InChIKey | AJRHHSHJRKDMEU-JOCHJYFZSA-N |
| XLogP | 4.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |