C16H18ClFN2O2S2 — CID 40863071
3-chloro-4-fluoro-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]benzenesulfonamide (PubChem CID 40863071) has the molecular formula C16H18ClFN2O2S2 and a molecular weight of 388.92 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-fluoro-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 40863071 |
| Molecular Formula | C16H18ClFN2O2S2 |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 3-chloro-4-fluoro-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC[C@H](c1ccsc1)N1CCCC1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H18ClFN2O2S2/c17-14-9-13(3-4-15(14)18)24(21,22)19-10-16(12-5-8-23-11-12)20-6-1-2-7-20/h3-5,8-9,11,16,19H,1-2,6-7,10H2/t16-/m1/s1 |
| InChIKey | WRYNBAZINWDUBY-MRXNPFEDSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |