C18H22FN3O3S2 — CID 16933081
N-[2-fluoro-4-[(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)sulfamoyl]phenyl]acetamide (PubChem CID 16933081) has the molecular formula C18H22FN3O3S2 and a molecular weight of 411.52 g/mol. Its IUPAC name is N-[2-fluoro-4-[(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-fluoro-4-[(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 16933081 |
| Molecular Formula | C18H22FN3O3S2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[2-fluoro-4-[(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCC(c2ccsc2)N2CCCC2)cc1F |
| InChI | InChI=1S/C18H22FN3O3S2/c1-13(23)21-17-5-4-15(10-16(17)19)27(24,25)20-11-18(14-6-9-26-12-14)22-7-2-3-8-22/h4-6,9-10,12,18,20H,2-3,7-8,11H2,1H3,(H,21,23) |
| InChIKey | VUDRAHHOAWUXFV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |