C22H31N3O3S2 — CID 16933277
N-[4-[[2-(azepan-1-yl)-2-thiophen-3-ylethyl]sulfamoyl]phenyl]butanamide (PubChem CID 16933277) has the molecular formula C22H31N3O3S2 and a molecular weight of 449.64 g/mol. Its IUPAC name is N-[4-[[2-(azepan-1-yl)-2-thiophen-3-ylethyl]sulfamoyl]phenyl]butanamide.
| Compound Name | N-[4-[[2-(azepan-1-yl)-2-thiophen-3-ylethyl]sulfamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 16933277 |
| Molecular Formula | C22H31N3O3S2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-[4-[[2-(azepan-1-yl)-2-thiophen-3-ylethyl]sulfamoyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(S(=O)(=O)NCC(c2ccsc2)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C22H31N3O3S2/c1-2-7-22(26)24-19-8-10-20(11-9-19)30(27,28)23-16-21(18-12-15-29-17-18)25-13-5-3-4-6-14-25/h8-12,15,17,21,23H,2-7,13-14,16H2,1H3,(H,24,26) |
| InChIKey | BQMHEOKDWUSFSI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |