C21H27N3O5S — CID 60529996
N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 60529996) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 60529996 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | COc1ccccc1C(CNS(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1)N1CCCCC1 |
| InChI | InChI=1S/C21H27N3O5S/c1-16-10-11-17(14-19(16)24(25)26)30(27,28)22-15-20(23-12-6-3-7-13-23)18-8-4-5-9-21(18)29-2/h4-5,8-11,14,20,22H,3,6-7,12-13,15H2,1-2H3 |
| InChIKey | BYPULNXMXQQLHA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|