C20H25N3O5S — CID 31481771
N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 31481771) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 31481771 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc([C@H](CNS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-15-5-10-18(13-19(15)23(24)25)29(26,27)21-14-20(22-11-3-4-12-22)16-6-8-17(28-2)9-7-16/h5-10,13,20-21H,3-4,11-12,14H2,1-2H3/t20-/m0/s1 |
| InChIKey | APVDLUQDYZTIAZ-FQEVSTJZSA-N |
| XLogP | 3.03 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|