C18H25N3O2S2 — CID 20962695
N-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]thiophene-2-sulfonamide (PubChem CID 20962695) has the molecular formula C18H25N3O2S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20962695 |
| Molecular Formula | C18H25N3O2S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]thiophene-2-sulfonamide |
| SMILES | CN(C)c1ccc(C(CNS(=O)(=O)c2cccs2)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H25N3O2S2/c1-20(2)16-9-7-15(8-10-16)17(21-11-3-4-12-21)14-19-25(22,23)18-6-5-13-24-18/h5-10,13,17,19H,3-4,11-12,14H2,1-2H3 |
| InChIKey | PYBOEDLQRIVWID-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|