C13H18N2O6S2 — CID 55705049
(1-morpholin-4-yl-1-oxopropan-2-yl) 2-(thiophen-2-ylsulfonylamino)acetate (PubChem CID 55705049) has the molecular formula C13H18N2O6S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (1-morpholin-4-yl-1-oxopropan-2-yl) 2-(thiophen-2-ylsulfonylamino)acetate.
| Compound Name | (1-morpholin-4-yl-1-oxopropan-2-yl) 2-(thiophen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 55705049 |
| Molecular Formula | C13H18N2O6S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | (1-morpholin-4-yl-1-oxopropan-2-yl) 2-(thiophen-2-ylsulfonylamino)acetate |
| SMILES | CC(OC(=O)CNS(=O)(=O)c1cccs1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H18N2O6S2/c1-10(13(17)15-4-6-20-7-5-15)21-11(16)9-14-23(18,19)12-3-2-8-22-12/h2-3,8,10,14H,4-7,9H2,1H3 |
| InChIKey | MUVMKZAFJPDYCB-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |