C18H23N3O4S2 — CID 48681561
N-[1-(4-morpholin-4-ylphenyl)ethyl]-2-(thiophen-2-ylsulfonylamino)acetamide (PubChem CID 48681561) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[1-(4-morpholin-4-ylphenyl)ethyl]-2-(thiophen-2-ylsulfonylamino)acetamide.
| Compound Name | N-[1-(4-morpholin-4-ylphenyl)ethyl]-2-(thiophen-2-ylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 48681561 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-[1-(4-morpholin-4-ylphenyl)ethyl]-2-(thiophen-2-ylsulfonylamino)acetamide |
| SMILES | CC(NC(=O)CNS(=O)(=O)c1cccs1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H23N3O4S2/c1-14(15-4-6-16(7-5-15)21-8-10-25-11-9-21)20-17(22)13-19-27(23,24)18-3-2-12-26-18/h2-7,12,14,19H,8-11,13H2,1H3,(H,20,22) |
| InChIKey | FTMSKYMDTJIZHE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|