C21H29N3O3S2 — CID 55474200
N-[1-(4-ethylphenyl)ethyl]-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide (PubChem CID 55474200) has the molecular formula C21H29N3O3S2 and a molecular weight of 435.62 g/mol. Its IUPAC name is N-[1-(4-ethylphenyl)ethyl]-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide.
| Compound Name | N-[1-(4-ethylphenyl)ethyl]-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55474200 |
| Molecular Formula | C21H29N3O3S2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[1-(4-ethylphenyl)ethyl]-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide |
| SMILES | CCc1ccc(C(C)NC(=O)CN2CCC(NS(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C21H29N3O3S2/c1-3-17-6-8-18(9-7-17)16(2)22-20(25)15-24-12-10-19(11-13-24)23-29(26,27)21-5-4-14-28-21/h4-9,14,16,19,23H,3,10-13,15H2,1-2H3,(H,22,25) |
| InChIKey | OIAIIUDSLPQHNK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |