C16H24ClN3O3S — CID 86914573
N-[1-(4-chlorophenyl)ethyl]-2-[4-(methanesulfonamido)piperidin-1-yl]acetamide (PubChem CID 86914573) has the molecular formula C16H24ClN3O3S and a molecular weight of 373.91 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-2-[4-(methanesulfonamido)piperidin-1-yl]acetamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-2-[4-(methanesulfonamido)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 86914573 |
| Molecular Formula | C16H24ClN3O3S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-2-[4-(methanesulfonamido)piperidin-1-yl]acetamide |
| SMILES | CC(NC(=O)CN1CCC(NS(C)(=O)=O)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClN3O3S/c1-12(13-3-5-14(17)6-4-13)18-16(21)11-20-9-7-15(8-10-20)19-24(2,22)23/h3-6,12,15,19H,7-11H2,1-2H3,(H,18,21) |
| InChIKey | HFDCZUHLWHJORZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |