C14H21ClN4O3S — CID 86919652
N-[1-(4-chlorophenyl)ethyl]-2-(4-sulfamoylpiperazin-1-yl)acetamide (PubChem CID 86919652) has the molecular formula C14H21ClN4O3S and a molecular weight of 360.87 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-2-(4-sulfamoylpiperazin-1-yl)acetamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-2-(4-sulfamoylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 86919652 |
| Molecular Formula | C14H21ClN4O3S |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-2-(4-sulfamoylpiperazin-1-yl)acetamide |
| SMILES | CC(NC(=O)CN1CCN(S(N)(=O)=O)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN4O3S/c1-11(12-2-4-13(15)5-3-12)17-14(20)10-18-6-8-19(9-7-18)23(16,21)22/h2-5,11H,6-10H2,1H3,(H,17,20)(H2,16,21,22) |
| InChIKey | AXKOMOJZBPDBQM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |