C21H25Cl2N3O — CID 42914266
N-[1-(4-chlorophenyl)ethyl]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 42914266) has the molecular formula C21H25Cl2N3O and a molecular weight of 406.36 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 42914266 |
| Molecular Formula | C21H25Cl2N3O |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | CC(NC(=O)CN1CCN(Cc2ccc(Cl)cc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25Cl2N3O/c1-16(18-4-8-20(23)9-5-18)24-21(27)15-26-12-10-25(11-13-26)14-17-2-6-19(22)7-3-17/h2-9,16H,10-15H2,1H3,(H,24,27) |
| InChIKey | JHWCVNBKSPZWKP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |