C19H23ClN4O3S — CID 134043087
N-[(4-chlorophenyl)-phenylmethyl]-2-(4-sulfamoylpiperazin-1-yl)acetamide (PubChem CID 134043087) has the molecular formula C19H23ClN4O3S and a molecular weight of 422.94 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-phenylmethyl]-2-(4-sulfamoylpiperazin-1-yl)acetamide.
| Compound Name | N-[(4-chlorophenyl)-phenylmethyl]-2-(4-sulfamoylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 134043087 |
| Molecular Formula | C19H23ClN4O3S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[(4-chlorophenyl)-phenylmethyl]-2-(4-sulfamoylpiperazin-1-yl)acetamide |
| SMILES | NS(=O)(=O)N1CCN(CC(=O)NC(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H23ClN4O3S/c20-17-8-6-16(7-9-17)19(15-4-2-1-3-5-15)22-18(25)14-23-10-12-24(13-11-23)28(21,26)27/h1-9,19H,10-14H2,(H,22,25)(H2,21,26,27) |
| InChIKey | NMHPPXMDBJWBOO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |