C13H19ClN4O3S — CID 134038865
N-(3-chloro-2-methylphenyl)-2-(4-sulfamoylpiperazin-1-yl)acetamide (PubChem CID 134038865) has the molecular formula C13H19ClN4O3S and a molecular weight of 346.84 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-(4-sulfamoylpiperazin-1-yl)acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-(4-sulfamoylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 134038865 |
| Molecular Formula | C13H19ClN4O3S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-(4-sulfamoylpiperazin-1-yl)acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CN1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C13H19ClN4O3S/c1-10-11(14)3-2-4-12(10)16-13(19)9-17-5-7-18(8-6-17)22(15,20)21/h2-4H,5-9H2,1H3,(H,16,19)(H2,15,20,21) |
| InChIKey | ITXSHRNRNHDRRS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |