C21H25Cl2N3O2 — CID 9260111
N-(3-chloro-2-methylphenyl)-2-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]acetamide (PubChem CID 9260111) has the molecular formula C21H25Cl2N3O2 and a molecular weight of 422.36 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9260111 |
| Molecular Formula | C21H25Cl2N3O2 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CN1CCN(CCOc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H25Cl2N3O2/c1-16-19(23)3-2-4-20(16)24-21(27)15-26-11-9-25(10-12-26)13-14-28-18-7-5-17(22)6-8-18/h2-8H,9-15H2,1H3,(H,24,27) |
| InChIKey | VVOCXHMOOPZQJT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |