C25H26Cl2N3O3S+ — CID 2507952
N-benzhydryl-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 2507952) has the molecular formula C25H26Cl2N3O3S+ and a molecular weight of 519.47 g/mol. Its IUPAC name is N-benzhydryl-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-benzhydryl-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2507952 |
| Molecular Formula | C25H26Cl2N3O3S+ |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | N-benzhydryl-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25Cl2N3O3S/c26-21-11-12-22(27)23(17-21)34(32,33)30-15-13-29(14-16-30)18-24(31)28-25(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-12,17,25H,13-16,18H2,(H,28,31)/p+1 |
| InChIKey | QQUQSUAPIMSXFI-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |