C14H19Cl2N4O4S+ — CID 8553782
N'-acetyl-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]acetohydrazide (PubChem CID 8553782) has the molecular formula C14H19Cl2N4O4S+ and a molecular weight of 410.30 g/mol. Its IUPAC name is N'-acetyl-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]acetohydrazide.
| Compound Name | N'-acetyl-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 8553782 |
| Molecular Formula | C14H19Cl2N4O4S+ |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | N'-acetyl-2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]acetohydrazide |
| SMILES | CC(=O)NNC(=O)C[NH+]1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H18Cl2N4O4S/c1-10(21)17-18-14(22)9-19-4-6-20(7-5-19)25(23,24)13-8-11(15)2-3-12(13)16/h2-3,8H,4-7,9H2,1H3,(H,17,21)(H,18,22)/p+1 |
| InChIKey | HNQJKZKICPUJSN-UHFFFAOYSA-O |
| XLogP | -0.95 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|