C10H11Cl2NO2S — CID 767694
1-(2,5-dichlorophenyl)sulfonylpyrrolidine (PubChem CID 767694) has the molecular formula C10H11Cl2NO2S and a molecular weight of 280.18 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonylpyrrolidine.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 767694 |
| Molecular Formula | C10H11Cl2NO2S |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Cl)N1CCCC1 |
| InChI | InChI=1S/C10H11Cl2NO2S/c11-8-3-4-9(12)10(7-8)16(14,15)13-5-1-2-6-13/h3-4,7H,1-2,5-6H2 |
| InChIKey | JVEVLWSAAUWYPE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |