C11H14ClNO4S2 — CID 35289014
1-(2-chloro-5-methylsulfonylphenyl)sulfonylpyrrolidine (PubChem CID 35289014) has the molecular formula C11H14ClNO4S2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 1-(2-chloro-5-methylsulfonylphenyl)sulfonylpyrrolidine.
| Compound Name | 1-(2-chloro-5-methylsulfonylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 35289014 |
| Molecular Formula | C11H14ClNO4S2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 1-(2-chloro-5-methylsulfonylphenyl)sulfonylpyrrolidine |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C11H14ClNO4S2/c1-18(14,15)9-4-5-10(12)11(8-9)19(16,17)13-6-2-3-7-13/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | REGJPIOFWWGHRX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |