C13H18ClNO4S2 — CID 35295703
1-(2-chloro-5-methylsulfonylphenyl)sulfonyl-4-methylpiperidine (PubChem CID 35295703) has the molecular formula C13H18ClNO4S2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 1-(2-chloro-5-methylsulfonylphenyl)sulfonyl-4-methylpiperidine.
| Compound Name | 1-(2-chloro-5-methylsulfonylphenyl)sulfonyl-4-methylpiperidine |
|---|---|
| PubChem CID | 35295703 |
| Molecular Formula | C13H18ClNO4S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 1-(2-chloro-5-methylsulfonylphenyl)sulfonyl-4-methylpiperidine |
| SMILES | CC1CCN(S(=O)(=O)c2cc(S(C)(=O)=O)ccc2Cl)CC1 |
| InChI | InChI=1S/C13H18ClNO4S2/c1-10-5-7-15(8-6-10)21(18,19)13-9-11(20(2,16)17)3-4-12(13)14/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | RHCAPZKTCVWBPX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |