C12H17ClN2O4S2 — CID 65449750
1-(2-chloro-5-methylsulfonylphenyl)sulfonyl-3-methylpiperazine (PubChem CID 65449750) has the molecular formula C12H17ClN2O4S2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 1-(2-chloro-5-methylsulfonylphenyl)sulfonyl-3-methylpiperazine.
| Compound Name | 1-(2-chloro-5-methylsulfonylphenyl)sulfonyl-3-methylpiperazine |
|---|---|
| PubChem CID | 65449750 |
| Molecular Formula | C12H17ClN2O4S2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 1-(2-chloro-5-methylsulfonylphenyl)sulfonyl-3-methylpiperazine |
| SMILES | CC1CN(S(=O)(=O)c2cc(S(C)(=O)=O)ccc2Cl)CCN1 |
| InChI | InChI=1S/C12H17ClN2O4S2/c1-9-8-15(6-5-14-9)21(18,19)12-7-10(20(2,16)17)3-4-11(12)13/h3-4,7,9,14H,5-6,8H2,1-2H3 |
| InChIKey | MNWBLDYQKUDVDN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |