C9H15N3O2S — CID 104975048
(3R)-3-methyl-1-(1H-pyrrol-3-ylsulfonyl)piperazine (PubChem CID 104975048) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is (3R)-3-methyl-1-(1H-pyrrol-3-ylsulfonyl)piperazine.
| Compound Name | (3R)-3-methyl-1-(1H-pyrrol-3-ylsulfonyl)piperazine |
|---|---|
| PubChem CID | 104975048 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (3R)-3-methyl-1-(1H-pyrrol-3-ylsulfonyl)piperazine |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cc[nH]c2)CCN1 |
| InChI | InChI=1S/C9H15N3O2S/c1-8-7-12(5-4-11-8)15(13,14)9-2-3-10-6-9/h2-3,6,8,10-11H,4-5,7H2,1H3/t8-/m1/s1 |
| InChIKey | YKZJJZHIIHOSQW-MRVPVSSYSA-N |
| XLogP | -0.00 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |