C12H15N3O2S — CID 65449200
4-(3-methylpiperazin-1-yl)sulfonylbenzonitrile (PubChem CID 65449200) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 4-(3-methylpiperazin-1-yl)sulfonylbenzonitrile.
| Compound Name | 4-(3-methylpiperazin-1-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 65449200 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-(3-methylpiperazin-1-yl)sulfonylbenzonitrile |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C#N)cc2)CCN1 |
| InChI | InChI=1S/C12H15N3O2S/c1-10-9-15(7-6-14-10)18(16,17)12-4-2-11(8-13)3-5-12/h2-5,10,14H,6-7,9H2,1H3 |
| InChIKey | NLHUCAPVTQXSCZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |