C13H19N3O3S — CID 22273336
N-[4-(3-methylpiperazin-1-yl)sulfonylphenyl]acetamide (PubChem CID 22273336) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[4-(3-methylpiperazin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | N-[4-(3-methylpiperazin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 22273336 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[4-(3-methylpiperazin-1-yl)sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCNC(C)C2)cc1 |
| InChI | InChI=1S/C13H19N3O3S/c1-10-9-16(8-7-14-10)20(18,19)13-5-3-12(4-6-13)15-11(2)17/h3-6,10,14H,7-9H2,1-2H3,(H,15,17) |
| InChIKey | ZBTBWMBWICDMFK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |