C15H24ClN3O5S2 — CID 119981794
4-[4-(3-methylpiperazin-1-yl)sulfonylphenyl]sulfonylmorpholine;hydrochloride (PubChem CID 119981794) has the molecular formula C15H24ClN3O5S2 and a molecular weight of 425.96 g/mol. Its IUPAC name is 4-[4-(3-methylpiperazin-1-yl)sulfonylphenyl]sulfonylmorpholine;hydrochloride.
| Compound Name | 4-[4-(3-methylpiperazin-1-yl)sulfonylphenyl]sulfonylmorpholine;hydrochloride |
|---|---|
| PubChem CID | 119981794 |
| Molecular Formula | C15H24ClN3O5S2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 4-[4-(3-methylpiperazin-1-yl)sulfonylphenyl]sulfonylmorpholine;hydrochloride |
| SMILES | CC1CN(S(=O)(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)CCN1.Cl |
| InChI | InChI=1S/C15H23N3O5S2.ClH/c1-13-12-18(7-6-16-13)25(21,22)15-4-2-14(3-5-15)24(19,20)17-8-10-23-11-9-17;/h2-5,13,16H,6-12H2,1H3;1H |
| InChIKey | QMAFQZJBZUNVIM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |