C11H16ClFN2O2S — CID 119981991
1-(3-fluorophenyl)sulfonyl-3-methylpiperazine;hydrochloride (PubChem CID 119981991) has the molecular formula C11H16ClFN2O2S and a molecular weight of 294.78 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-3-methylpiperazine;hydrochloride.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-3-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 119981991 |
| Molecular Formula | C11H16ClFN2O2S |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-3-methylpiperazine;hydrochloride |
| SMILES | CC1CN(S(=O)(=O)c2cccc(F)c2)CCN1.Cl |
| InChI | InChI=1S/C11H15FN2O2S.ClH/c1-9-8-14(6-5-13-9)17(15,16)11-4-2-3-10(12)7-11;/h2-4,7,9,13H,5-6,8H2,1H3;1H |
| InChIKey | BCUJQTPWNAFIBB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |