C12H16ClF3N2O3S — CID 119982212
3-methyl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperazine;hydrochloride (PubChem CID 119982212) has the molecular formula C12H16ClF3N2O3S and a molecular weight of 360.79 g/mol. Its IUPAC name is 3-methyl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperazine;hydrochloride.
| Compound Name | 3-methyl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 119982212 |
| Molecular Formula | C12H16ClF3N2O3S |
| Molecular Weight | 360.79 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 3-methyl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperazine;hydrochloride |
| SMILES | CC1CN(S(=O)(=O)c2cccc(OC(F)(F)F)c2)CCN1.Cl |
| InChI | InChI=1S/C12H15F3N2O3S.ClH/c1-9-8-17(6-5-16-9)21(18,19)11-4-2-3-10(7-11)20-12(13,14)15;/h2-4,7,9,16H,5-6,8H2,1H3;1H |
| InChIKey | DPUSXRUJNKDRNJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.79 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |