C13H16ClN3O3S — CID 104976462
6-chloro-5-[(3S)-3-methylpiperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one (PubChem CID 104976462) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is 6-chloro-5-[(3S)-3-methylpiperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[(3S)-3-methylpiperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 104976462 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 6-chloro-5-[(3S)-3-methylpiperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cc3c(cc2Cl)NC(=O)C3)CCN1 |
| InChI | InChI=1S/C13H16ClN3O3S/c1-8-7-17(3-2-15-8)21(19,20)12-4-9-5-13(18)16-11(9)6-10(12)14/h4,6,8,15H,2-3,5,7H2,1H3,(H,16,18)/t8-/m0/s1 |
| InChIKey | NMXBXVGAXBIJBM-QMMMGPOBSA-N |
| XLogP | 0.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |