C13H16ClN3O3S — CID 104982613
6-chloro-2-oxo-N-[(3S)-piperidin-3-yl]-1,3-dihydroindole-5-sulfonamide (PubChem CID 104982613) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is 6-chloro-2-oxo-N-[(3S)-piperidin-3-yl]-1,3-dihydroindole-5-sulfonamide.
| Compound Name | 6-chloro-2-oxo-N-[(3S)-piperidin-3-yl]-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 104982613 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 6-chloro-2-oxo-N-[(3S)-piperidin-3-yl]-1,3-dihydroindole-5-sulfonamide |
| SMILES | O=C1Cc2cc(S(=O)(=O)N[C@H]3CCCNC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C13H16ClN3O3S/c14-10-6-11-8(5-13(18)16-11)4-12(10)21(19,20)17-9-2-1-3-15-7-9/h4,6,9,15,17H,1-3,5,7H2,(H,16,18)/t9-/m0/s1 |
| InChIKey | ZZUQPEPLMRATBJ-VIFPVBQESA-N |
| XLogP | 0.86 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |