C14H17ClN2O2 — CID 43457516
6-chloro-5-[hydroxy(piperidin-3-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 43457516) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 6-chloro-5-[hydroxy(piperidin-3-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[hydroxy(piperidin-3-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43457516 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 6-chloro-5-[hydroxy(piperidin-3-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(O)C3CCCNC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C14H17ClN2O2/c15-11-6-12-9(5-13(18)17-12)4-10(11)14(19)8-2-1-3-16-7-8/h4,6,8,14,16,19H,1-3,5,7H2,(H,17,18) |
| InChIKey | QMMUPGPIXBKJFS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |