C15H18ClN3O2 — CID 62676310
N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-piperidin-3-ylacetamide (PubChem CID 62676310) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-piperidin-3-ylacetamide.
| Compound Name | N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-piperidin-3-ylacetamide |
|---|---|
| PubChem CID | 62676310 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-piperidin-3-ylacetamide |
| SMILES | O=C(CC1CCCNC1)Nc1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C15H18ClN3O2/c16-11-7-12-10(6-15(21)18-12)5-13(11)19-14(20)4-9-2-1-3-17-8-9/h5,7,9,17H,1-4,6,8H2,(H,18,21)(H,19,20) |
| InChIKey | XGWJMIYDVTUNIL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |