C13H15ClN2O3 — CID 79200976
N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-4-hydroxypentanamide (PubChem CID 79200976) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-4-hydroxypentanamide.
| Compound Name | N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-4-hydroxypentanamide |
|---|---|
| PubChem CID | 79200976 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-4-hydroxypentanamide |
| SMILES | CC(O)CCC(=O)Nc1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C13H15ClN2O3/c1-7(17)2-3-12(18)16-11-4-8-5-13(19)15-10(8)6-9(11)14/h4,6-7,17H,2-3,5H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | RRJXMWHDKFKRMB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |