C14H18ClN3O2 — CID 43704875
2-amino-N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-4-methylpentanamide (PubChem CID 43704875) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 2-amino-N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-4-methylpentanamide.
| Compound Name | 2-amino-N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 43704875 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-amino-N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-4-methylpentanamide |
| SMILES | CC(C)CC(N)C(=O)Nc1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C14H18ClN3O2/c1-7(2)3-10(16)14(20)18-12-4-8-5-13(19)17-11(8)6-9(12)15/h4,6-7,10H,3,5,16H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | IISLACBMTKPEBR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |