C12H13ClN4O3 — CID 60848687
2-amino-N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)butanediamide (PubChem CID 60848687) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is 2-amino-N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)butanediamide.
| Compound Name | 2-amino-N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)butanediamide |
|---|---|
| PubChem CID | 60848687 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-amino-N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)butanediamide |
| SMILES | NC(=O)CC(N)C(=O)Nc1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C12H13ClN4O3/c13-6-3-8-5(2-11(19)16-8)1-9(6)17-12(20)7(14)4-10(15)18/h1,3,7H,2,4,14H2,(H2,15,18)(H,16,19)(H,17,20) |
| InChIKey | ZMYYZPYRJBBMEF-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |