C17H25ClN2O — CID 43691740
6-chloro-5-(nonan-2-ylamino)-1,3-dihydroindol-2-one (PubChem CID 43691740) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 6-chloro-5-(nonan-2-ylamino)-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-(nonan-2-ylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43691740 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 6-chloro-5-(nonan-2-ylamino)-1,3-dihydroindol-2-one |
| SMILES | CCCCCCCC(C)Nc1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C17H25ClN2O/c1-3-4-5-6-7-8-12(2)19-16-9-13-10-17(21)20-15(13)11-14(16)18/h9,11-12,19H,3-8,10H2,1-2H3,(H,20,21) |
| InChIKey | XVTSRYJHJMGAIZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|