C15H21ClN2O — CID 43487561
6-chloro-5-[1-(methylamino)hexyl]-1,3-dihydroindol-2-one (PubChem CID 43487561) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 6-chloro-5-[1-(methylamino)hexyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[1-(methylamino)hexyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43487561 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 6-chloro-5-[1-(methylamino)hexyl]-1,3-dihydroindol-2-one |
| SMILES | CCCCCC(NC)c1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C15H21ClN2O/c1-3-4-5-6-13(17-2)11-7-10-8-15(19)18-14(10)9-12(11)16/h7,9,13,17H,3-6,8H2,1-2H3,(H,18,19) |
| InChIKey | MXHPDUCSWQBDMQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|