C14H19BrN2O — CID 114243983
5-(1-aminohexyl)-6-bromo-1,3-dihydroindol-2-one (PubChem CID 114243983) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is 5-(1-aminohexyl)-6-bromo-1,3-dihydroindol-2-one.
| Compound Name | 5-(1-aminohexyl)-6-bromo-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 114243983 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-(1-aminohexyl)-6-bromo-1,3-dihydroindol-2-one |
| SMILES | CCCCCC(N)c1cc2c(cc1Br)NC(=O)C2 |
| InChI | InChI=1S/C14H19BrN2O/c1-2-3-4-5-12(16)10-6-9-7-14(18)17-13(9)8-11(10)15/h6,8,12H,2-5,7,16H2,1H3,(H,17,18) |
| InChIKey | UYSAJSKVWSKLTD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|