C18H26BrNO — CID 65428909
5-(1-bromodecyl)-1,3-dihydroindol-2-one (PubChem CID 65428909) has the molecular formula C18H26BrNO and a molecular weight of 352.32 g/mol. Its IUPAC name is 5-(1-bromodecyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(1-bromodecyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 65428909 |
| Molecular Formula | C18H26BrNO |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 5-(1-bromodecyl)-1,3-dihydroindol-2-one |
| SMILES | CCCCCCCCCC(Br)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C18H26BrNO/c1-2-3-4-5-6-7-8-9-16(19)14-10-11-17-15(12-14)13-18(21)20-17/h10-12,16H,2-9,13H2,1H3,(H,20,21) |
| InChIKey | NWHFQVLEPRKIKP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|