C12H17NO — CID 160830162
methane;5-propan-2-yl-1,3-dihydroindol-2-one (PubChem CID 160830162) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is methane;5-propan-2-yl-1,3-dihydroindol-2-one.
| Compound Name | methane;5-propan-2-yl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 160830162 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | methane;5-propan-2-yl-1,3-dihydroindol-2-one |
| SMILES | C.CC(C)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C11H13NO.CH4/c1-7(2)8-3-4-10-9(5-8)6-11(13)12-10;/h3-5,7H,6H2,1-2H3,(H,12,13);1H4 |
| InChIKey | SGRRVEFMVZFRNU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |