C12H18N2O2 — CID 176993371
molecular hydrogen;7-propan-2-yl-1,5-dihydro-1,5-benzodiazepine-2,4-dione (PubChem CID 176993371) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is molecular hydrogen;7-propan-2-yl-1,5-dihydro-1,5-benzodiazepine-2,4-dione.
| Compound Name | molecular hydrogen;7-propan-2-yl-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 176993371 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | molecular hydrogen;7-propan-2-yl-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
| SMILES | CC(C)c1ccc2c(c1)NC(=O)CC(=O)N2.[H][H].[H][H] |
| InChI | InChI=1S/C12H14N2O2.2H2/c1-7(2)8-3-4-9-10(5-8)14-12(16)6-11(15)13-9;;/h3-5,7H,6H2,1-2H3,(H,13,15)(H,14,16);2*1H |
| InChIKey | IAGLSTBFSVQTTI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|