C16H22N2O3 — CID 114753375
7-(1-hydroxyheptyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione (PubChem CID 114753375) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 7-(1-hydroxyheptyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-(1-hydroxyheptyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 114753375 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 7-(1-hydroxyheptyl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
| SMILES | CCCCCCC(O)c1ccc2c(c1)NC(=O)CC(=O)N2 |
| InChI | InChI=1S/C16H22N2O3/c1-2-3-4-5-6-14(19)11-7-8-12-13(9-11)18-16(21)10-15(20)17-12/h7-9,14,19H,2-6,10H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | DGWRKRAGYXGWLF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|