C15H22N2O2 — CID 62300603
5-(1-hydroxyhexyl)-1,3-dimethylbenzimidazol-2-one (PubChem CID 62300603) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-(1-hydroxyhexyl)-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-(1-hydroxyhexyl)-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 62300603 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 5-(1-hydroxyhexyl)-1,3-dimethylbenzimidazol-2-one |
| SMILES | CCCCCC(O)c1ccc2c(c1)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H22N2O2/c1-4-5-6-7-14(18)11-8-9-12-13(10-11)17(3)15(19)16(12)2/h8-10,14,18H,4-7H2,1-3H3 |
| InChIKey | FAGVGRMZVWGOEN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|