C25H35N3O3 — CID 124546812
5-[(1R)-2-[4-[(heptylamino)methyl]phenoxy]-1-hydroxyethyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 124546812) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 5-[(1R)-2-[4-[(heptylamino)methyl]phenoxy]-1-hydroxyethyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[(1R)-2-[4-[(heptylamino)methyl]phenoxy]-1-hydroxyethyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 124546812 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 5-[(1R)-2-[4-[(heptylamino)methyl]phenoxy]-1-hydroxyethyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | CCCCCCCNCc1ccc(OC[C@H](O)c2ccc3c(c2)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C25H35N3O3/c1-4-5-6-7-8-15-26-17-19-9-12-21(13-10-19)31-18-24(29)20-11-14-22-23(16-20)28(3)25(30)27(22)2/h9-14,16,24,26,29H,4-8,15,17-18H2,1-3H3/t24-/m0/s1 |
| InChIKey | ZHDJXHABYDDVLK-DEOSSOPVSA-N |
| XLogP | 4.05 |
| TPSA | 68.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|