C26H29N3O3 — CID 17123388
5-[1-hydroxy-2-[4-[(2-phenylethylamino)methyl]phenoxy]ethyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 17123388) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 5-[1-hydroxy-2-[4-[(2-phenylethylamino)methyl]phenoxy]ethyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[1-hydroxy-2-[4-[(2-phenylethylamino)methyl]phenoxy]ethyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 17123388 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 5-[1-hydroxy-2-[4-[(2-phenylethylamino)methyl]phenoxy]ethyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(C(O)COc3ccc(CNCCc4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C26H29N3O3/c1-28-23-13-10-21(16-24(23)29(2)26(28)31)25(30)18-32-22-11-8-20(9-12-22)17-27-15-14-19-6-4-3-5-7-19/h3-13,16,25,27,30H,14-15,17-18H2,1-2H3 |
| InChIKey | KFALAGXYKBVOGG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|