C27H31N3O4 — CID 17207444
5-[1-hydroxy-2-[4-[[2-(2-methoxyphenyl)ethylamino]methyl]phenoxy]ethyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 17207444) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 5-[1-hydroxy-2-[4-[[2-(2-methoxyphenyl)ethylamino]methyl]phenoxy]ethyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[1-hydroxy-2-[4-[[2-(2-methoxyphenyl)ethylamino]methyl]phenoxy]ethyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 17207444 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 5-[1-hydroxy-2-[4-[[2-(2-methoxyphenyl)ethylamino]methyl]phenoxy]ethyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | COc1ccccc1CCNCc1ccc(OCC(O)c2ccc3c(c2)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C27H31N3O4/c1-29-23-13-10-21(16-24(23)30(2)27(29)32)25(31)18-34-22-11-8-19(9-12-22)17-28-15-14-20-6-4-5-7-26(20)33-3/h4-13,16,25,28,31H,14-15,17-18H2,1-3H3 |
| InChIKey | KUXRHGPTIOWMPV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|