C26H30N4O5S — CID 51988200
4-[2-[[4-[(2R)-2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-hydroxyethoxy]phenyl]methylamino]ethyl]benzenesulfonamide (PubChem CID 51988200) has the molecular formula C26H30N4O5S and a molecular weight of 510.62 g/mol. Its IUPAC name is 4-[2-[[4-[(2R)-2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-hydroxyethoxy]phenyl]methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[4-[(2R)-2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-hydroxyethoxy]phenyl]methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51988200 |
| Molecular Formula | C26H30N4O5S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 4-[2-[[4-[(2R)-2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-hydroxyethoxy]phenyl]methylamino]ethyl]benzenesulfonamide |
| SMILES | Cn1c(=O)n(C)c2cc([C@@H](O)COc3ccc(CNCCc4ccc(S(N)(=O)=O)cc4)cc3)ccc21 |
| InChI | InChI=1S/C26H30N4O5S/c1-29-23-12-7-20(15-24(23)30(2)26(29)32)25(31)17-35-21-8-3-19(4-9-21)16-28-14-13-18-5-10-22(11-6-18)36(27,33)34/h3-12,15,25,28,31H,13-14,16-17H2,1-2H3,(H2,27,33,34)/t25-/m0/s1 |
| InChIKey | MPMQNTPGSZGKNA-VWLOTQADSA-N |
| XLogP | 1.97 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|