C17H25NO3 — CID 65426000
6-(1-hydroxydecyl)-3H-1,3-benzoxazol-2-one (PubChem CID 65426000) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 6-(1-hydroxydecyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(1-hydroxydecyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 65426000 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 6-(1-hydroxydecyl)-3H-1,3-benzoxazol-2-one |
| SMILES | CCCCCCCCCC(O)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C17H25NO3/c1-2-3-4-5-6-7-8-9-15(19)13-10-11-14-16(12-13)21-17(20)18-14/h10-12,15,19H,2-9H2,1H3,(H,18,20) |
| InChIKey | YYGORKVYCRGBML-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|