C17H24ClNO2 — CID 65426013
6-(1-chlorodecyl)-3H-1,3-benzoxazol-2-one (PubChem CID 65426013) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 6-(1-chlorodecyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(1-chlorodecyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 65426013 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 6-(1-chlorodecyl)-3H-1,3-benzoxazol-2-one |
| SMILES | CCCCCCCCCC(Cl)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C17H24ClNO2/c1-2-3-4-5-6-7-8-9-14(18)13-10-11-15-16(12-13)21-17(20)19-15/h10-12,14H,2-9H2,1H3,(H,19,20) |
| InChIKey | RGBARBWOUSAULU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|