C16H14ClNO2 — CID 61084211
6-[1-chloro-2-(4-methylphenyl)ethyl]-3H-1,3-benzoxazol-2-one (PubChem CID 61084211) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 6-[1-chloro-2-(4-methylphenyl)ethyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[1-chloro-2-(4-methylphenyl)ethyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 61084211 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 6-[1-chloro-2-(4-methylphenyl)ethyl]-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1ccc(CC(Cl)c2ccc3[nH]c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C16H14ClNO2/c1-10-2-4-11(5-3-10)8-13(17)12-6-7-14-15(9-12)20-16(19)18-14/h2-7,9,13H,8H2,1H3,(H,18,19) |
| InChIKey | LRKAYRVBTIDTLE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|